Products 1951425-03-8
CAS 1951425-03-8 is the registry number for (1S,2S)-2-(3,5-Difluorobenzyloxy)cyclohexanamine, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Trans-(1S,2S)-2-[(3,5-difluorophenyl)methoxy]cyclohexan-1-amine (CAS 1951425-03-8) is a chemical compound with the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. IUPAC name: trans-(1S,2S)-2-[(3,5-difluorophenyl)methoxy]cyclohexan-1-amine. InChIKey: ZELWUQLZFVBFDN-STQMWFEESA-N.
| Molecular formula | C13H17F2NO |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | trans-(1S,2S)-2-[(3,5-difluorophenyl)methoxy]cyclohexan-1-amine |
| InChIKey | ZELWUQLZFVBFDN-STQMWFEESA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)OCC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)