Products 1447016-25-2
CAS 1447016-25-2 is the registry number for 5-Hydroxy-3,6-dimethoxy-2-methyl-1,4-naphthoquinone. Offered by: TRC. Available pack sizes: 100mg.
5-hydroxy-3,6-dimethoxy-2-methylnaphthalene-1,4-dione (CAS 1447016-25-2) is a chemical compound with the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. IUPAC name: 5-hydroxy-3,6-dimethoxy-2-methylnaphthalene-1,4-dione. InChIKey: WBIIXLONAPDMOO-UHFFFAOYSA-N.
| Molecular formula | C13H12O5 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 5-hydroxy-3,6-dimethoxy-2-methylnaphthalene-1,4-dione |
| InChIKey | WBIIXLONAPDMOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)C=CC(=C2O)OC)OC |
Computed by PubChem (NCBI)