Products 14474-04-5
CAS 14474-04-5 is the registry number for L-Gulurono-6,3-lactone. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 5mg.
(2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde (CAS 14474-04-5) is a chemical compound with the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. IUPAC name: (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde. InChIKey: UYUXSRADSPPKRZ-TXICZTDVSA-N.
| Molecular formula | C6H8O6 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde |
| InChIKey | UYUXSRADSPPKRZ-TXICZTDVSA-N |
| SMILES | C(=O)[C@H]([C@@H]1[C@@H]([C@H](C(=O)O1)O)O)O |
Computed by PubChem (NCBI)