Products 14474-22-7
CAS 14474-22-7 is the registry number for Phenacetin Impurity 20. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-phenyldiazenylbenzoic acid (CAS 14474-22-7) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 3-phenyldiazenylbenzoic acid. InChIKey: PSIKAQNVARWEFI-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-phenyldiazenylbenzoic acid |
| InChIKey | PSIKAQNVARWEFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzoic acid, 3-(phenylazo)-, 3-phenyldiazenylbenzoic acid, (E)-3-(phenyldiazenyl)benzoic acid, 3-[(E)-Phenyldiazenyl]benzoic acid, (E)-Azobenzene-3-carboxylic acid, Mesalamine Impurity 02, m-Carboxy-trans-azobenzene, 3-(Phenylazo)benzoic acid, azobenzen-3-carboxylic acid, trans-3-Phenylazobenzoic acid