CAS 144742-32-5 appears in our catalog under these names: 6-(1-Piperazinyl)-1,3,5-triazine-2,4(1h,3h)-dione, 95%, 6-(Piperazin-1-yl)-1,3,5-triazine-2,4(1H,3H)-dione, 97%, 6-(1-Piperazinyl)-1,3,5-triazine-2,4(1H,3H)-dione, ≥95%, ≥95%, 6-(1-PIPERAZINYL)-1,3,5-TRIAZINE-2,4(1H,3H)-DIONE, >=95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-piperazin-1-yl-1H-1,3,5-triazine-2,4-dione (CAS 144742-32-5) is a chemical compound with the molecular formula C7H11N5O2 and a molecular weight of 197.19 g/mol. IUPAC name: 6-piperazin-1-yl-1H-1,3,5-triazine-2,4-dione. InChIKey: RJORERBFPGLTAB-UHFFFAOYSA-N.
| Molecular formula | C7H11N5O2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 6-piperazin-1-yl-1H-1,3,5-triazine-2,4-dione |
| InChIKey | RJORERBFPGLTAB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC(=O)NC(=O)N2 |
Computed by PubChem (NCBI)