CAS 450344-65-7 is the registry number for 5-Nitro-N4-propylpyrimidine-4,6-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitro-4-N-propylpyrimidine-4,6-diamine (CAS 450344-65-7) is a chemical compound with the molecular formula C7H11N5O2 and a molecular weight of 197.19 g/mol. IUPAC name: 5-nitro-4-N-propylpyrimidine-4,6-diamine. InChIKey: ADOPDOOIYHHOAP-UHFFFAOYSA-N.
| Molecular formula | C7H11N5O2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 5-nitro-4-N-propylpyrimidine-4,6-diamine |
| InChIKey | ADOPDOOIYHHOAP-UHFFFAOYSA-N |
| SMILES | CCCNC1=NC=NC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)