CAS 252944-01-7 appears in our catalog under these names: N6-(2-Aminoethyl)-3-nitro-2,6-pyridinediamine, 95%, N6–(2–Aminoethyl)–3–nitro–2,6–pyridinediamine, 2,6-Diamino-N2-(2-aminoethyl)-5-nitropyridine, >98.0%(HPLC), N2-(2-Aminoethyl)-5-nitropyridine-2,6-diamine, 98.0%, 98.0%, N2-(2-Aminoethyl)-5-nitropyridine-2,6-diamine, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 25mg, 500mg, 50mg.
6-N-(2-aminoethyl)-3-nitropyridine-2,6-diamine (CAS 252944-01-7) is a chemical compound with the molecular formula C7H11N5O2 and a molecular weight of 197.19 g/mol. IUPAC name: 6-N-(2-aminoethyl)-3-nitropyridine-2,6-diamine. InChIKey: JNXKEBLSRILDQM-UHFFFAOYSA-N.
| Molecular formula | C7H11N5O2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 6-N-(2-aminoethyl)-3-nitropyridine-2,6-diamine |
| InChIKey | JNXKEBLSRILDQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])N)NCCN |
Computed by PubChem (NCBI)