Products 1447608-02-7

CAS 1447608-02-7 is the registry number for Ethyl 1,5-naphthyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 1,5-naphthyridine-3-carboxylate (CAS 1447608-02-7) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: ethyl 1,5-naphthyridine-3-carboxylate. InChIKey: ARMFCDDVBRLZCM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O2
Molecular weight202.21 g/mol
IUPAC nameethyl 1,5-naphthyridine-3-carboxylate
InChIKeyARMFCDDVBRLZCM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=CC=N2)N=C1

Computed by PubChem (NCBI)