CAS 1447663-61-7 is the registry number for 1H-Imidazole-2-carboximidamide acetate, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 250mg.
Acetic acid;1H-imidazole-2-carboximidamide (CAS 1447663-61-7) is a chemical compound with the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. IUPAC name: acetic acid;1H-imidazole-2-carboximidamide. InChIKey: GHAMYQQBAIOVSC-UHFFFAOYSA-N.
| Molecular formula | C6H10N4O2 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | acetic acid;1H-imidazole-2-carboximidamide |
| InChIKey | GHAMYQQBAIOVSC-UHFFFAOYSA-N |
| SMILES | CC(=O)O.C1=CN=C(N1)C(=N)N |
Computed by PubChem (NCBI)