Products 1447671-88-6
CAS 1447671-88-6 is the registry number for 1,3-Dibromo-5-(2,2,2-trifluoroethyl)benzene, 98%. Offered by: Fluorochem. Available pack sizes: 250mg.
1,3-dibromo-5-(2,2,2-trifluoroethyl)benzene (CAS 1447671-88-6) is a chemical compound with the molecular formula C8H5Br2F3 and a molecular weight of 317.93 g/mol. IUPAC name: 1,3-dibromo-5-(2,2,2-trifluoroethyl)benzene. InChIKey: NPLOOFANXFUISM-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3 |
|---|---|
| Molecular weight | 317.93 g/mol |
| IUPAC name | 1,3-dibromo-5-(2,2,2-trifluoroethyl)benzene |
| InChIKey | NPLOOFANXFUISM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)CC(F)(F)F |
Computed by PubChem (NCBI)