CAS 1447763-50-9 appears in our catalog under these names: 4-(Carboxy)cyclohexene-1-boronic acid, pinacol ester, 98%, 4-(Carboxy)cyclohexene-1-boronic acid, pinacol ester, 98%, 98%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid, 98%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-enecarboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid (CAS 1447763-50-9) is a chemical compound with the molecular formula C13H21BO4 and a molecular weight of 252.12 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid. InChIKey: TVALPBGGKJPQPW-UHFFFAOYSA-N.
| Molecular formula | C13H21BO4 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid |
| InChIKey | TVALPBGGKJPQPW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)