CAS 1449522-62-6 is the registry number for Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-1-ene-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentene-1-carboxylate (CAS 1449522-62-6) is a chemical compound with the molecular formula C13H21BO4 and a molecular weight of 252.12 g/mol. IUPAC name: methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentene-1-carboxylate. InChIKey: FYYQTIXVEZANCC-UHFFFAOYSA-N.
| Molecular formula | C13H21BO4 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentene-1-carboxylate |
| InChIKey | FYYQTIXVEZANCC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(CCC2)C(=O)OC |
Computed by PubChem (NCBI)