CAS 2223030-67-7 appears in our catalog under these names: 5–(1–Hydroxy–1–methylethyl)furan–2–boronic acid pinacol ester, 2-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl)propan-2-ol, 85+%. Offered by: GLPBio, Ambeed. Available pack sizes: 25mg, 5mg, 100mg, 250mg, 1g.
2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]propan-2-ol (CAS 2223030-67-7) is a chemical compound with the molecular formula C13H21BO4 and a molecular weight of 252.12 g/mol. IUPAC name: 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]propan-2-ol. InChIKey: OWBINMZMDSNGQT-UHFFFAOYSA-N.
| Molecular formula | C13H21BO4 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]propan-2-ol |
| InChIKey | OWBINMZMDSNGQT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)C(C)(C)O |
Computed by PubChem (NCBI)