CAS 144790-01-2 is the registry number for 2–Azetidinone, 3–(acetyloxy)–4–phenyl–, (3R,4S)–. Offered by: GLPBio. Available pack sizes: 1g.
[(3R,4S)-2-oxo-4-phenylazetidin-3-yl] acetate (CAS 144790-01-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: [(3R,4S)-2-oxo-4-phenylazetidin-3-yl] acetate. InChIKey: YTBSMLRVFPHDOB-VHSXEESVSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | [(3R,4S)-2-oxo-4-phenylazetidin-3-yl] acetate |
| InChIKey | YTBSMLRVFPHDOB-VHSXEESVSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)