CAS 1447913-55-4 appears in our catalog under these names: 5-Trifluoromethyl-thiophene-3-carboxylic acid methyl ester, 90%, Methyl 5-(trifluoromethyl)thiophene-3-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 5-(trifluoromethyl)thiophene-3-carboxylate (CAS 1447913-55-4) is a chemical compound with the molecular formula C7H5F3O2S and a molecular weight of 210.18 g/mol. IUPAC name: methyl 5-(trifluoromethyl)thiophene-3-carboxylate. InChIKey: RQHJZTIWHSEZMF-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2S |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | methyl 5-(trifluoromethyl)thiophene-3-carboxylate |
| InChIKey | RQHJZTIWHSEZMF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)