CAS 153698-38-5 appears in our catalog under these names: 1-Difluoromethanesulfonyl-4-fluorobenzene, 97%, 1-((Difluoromethyl)sulfonyl)-4-fluorobenzene 95%, 1-Difluoromethanesulfonyl-4-fluorobenzene, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 500mg.
1-(difluoromethylsulfonyl)-4-fluorobenzene (CAS 153698-38-5) is a chemical compound with the molecular formula C7H5F3O2S and a molecular weight of 210.18 g/mol. IUPAC name: 1-(difluoromethylsulfonyl)-4-fluorobenzene. InChIKey: UPINLVQNYWNAKK-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2S |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 1-(difluoromethylsulfonyl)-4-fluorobenzene |
| InChIKey | UPINLVQNYWNAKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)