CAS 845616-49-1 is the registry number for 1,2,4-Trifluoro-5-(methylsulfonyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1,2,4-trifluoro-5-methylsulfonylbenzene (CAS 845616-49-1) is a chemical compound with the molecular formula C7H5F3O2S and a molecular weight of 210.18 g/mol. IUPAC name: 1,2,4-trifluoro-5-methylsulfonylbenzene. InChIKey: YEDVSIZGMYQNOU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2S |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 1,2,4-trifluoro-5-methylsulfonylbenzene |
| InChIKey | YEDVSIZGMYQNOU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C(=C1)F)F)F |
Computed by PubChem (NCBI)