Products 1447942-35-9
CAS 1447942-35-9 is the registry number for Benzyl 6-Oxospiro[3.3]Heptane-2-Carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Benzyl 2-oxospiro[3.3]heptane-6-carboxylate (CAS 1447942-35-9) is a chemical compound with the molecular formula C15H16O3 and a molecular weight of 244.28 g/mol. IUPAC name: benzyl 2-oxospiro[3.3]heptane-6-carboxylate. InChIKey: JVTBEJJGKUTHQW-UHFFFAOYSA-N.
| Molecular formula | C15H16O3 |
|---|---|
| Molecular weight | 244.28 g/mol |
| IUPAC name | benzyl 2-oxospiro[3.3]heptane-6-carboxylate |
| InChIKey | JVTBEJJGKUTHQW-UHFFFAOYSA-N |
| SMILES | C1C(CC12CC(=O)C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)