CAS 1447942-39-3 is the registry number for rel-(1R,5S,6r)-3,3-Difluorobicyclo(3.1.0)hexane-6-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(1S,5R)-3,3-difluorobicyclo[3.1.0]hexane-6-carboxylic acid (CAS 1447942-39-3) is a chemical compound with the molecular formula C7H8F2O2 and a molecular weight of 162.13 g/mol. IUPAC name: (1S,5R)-3,3-difluorobicyclo[3.1.0]hexane-6-carboxylic acid. InChIKey: UHCURIODBIIVRJ-NGQZWQHPSA-N.
| Molecular formula | C7H8F2O2 |
|---|---|
| Molecular weight | 162.13 g/mol |
| IUPAC name | (1S,5R)-3,3-difluorobicyclo[3.1.0]hexane-6-carboxylic acid |
| InChIKey | UHCURIODBIIVRJ-NGQZWQHPSA-N |
| SMILES | C1[C@@H]2[C@@H](C2C(=O)O)CC1(F)F |
Computed by PubChem (NCBI)