CAS 1447966-08-6 is the registry number for 2-(5-(2,2-Dimethylpropanoyl)thiophen-2-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-[5-(2,2-dimethylpropanoyl)thiophen-2-yl]acetic acid (CAS 1447966-08-6) is a chemical compound with the molecular formula C11H14O3S and a molecular weight of 226.29 g/mol. IUPAC name: 2-[5-(2,2-dimethylpropanoyl)thiophen-2-yl]acetic acid. InChIKey: RSLZOXMFFAMYQE-UHFFFAOYSA-N.
| Molecular formula | C11H14O3S |
|---|---|
| Molecular weight | 226.29 g/mol |
| IUPAC name | 2-[5-(2,2-dimethylpropanoyl)thiophen-2-yl]acetic acid |
| InChIKey | RSLZOXMFFAMYQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(S1)CC(=O)O |
Computed by PubChem (NCBI)