CAS 924859-45-0 is the registry number for 7-Methyl-2,3,4,5-tetrahydro-1-benzothiepin-5-ol 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-methyl-1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol (CAS 924859-45-0) is a chemical compound with the molecular formula C11H14O3S and a molecular weight of 226.29 g/mol. IUPAC name: 7-methyl-1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol. InChIKey: ATXCOEMGBKEFOQ-UHFFFAOYSA-N.
| Molecular formula | C11H14O3S |
|---|---|
| Molecular weight | 226.29 g/mol |
| IUPAC name | 7-methyl-1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol |
| InChIKey | ATXCOEMGBKEFOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)S(=O)(=O)CCCC2O |
Computed by PubChem (NCBI)