Products 209790-17-0

CAS 209790-17-0 is the registry number for 2,3-Dihydro-1H-inden-1-ylmethyl methanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-inden-1-ylmethyl methanesulfonate (CAS 209790-17-0) is a chemical compound with the molecular formula C11H14O3S and a molecular weight of 226.29 g/mol. IUPAC name: 2,3-dihydro-1H-inden-1-ylmethyl methanesulfonate. InChIKey: CAGQBHMUTKYQIO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O3S
Molecular weight226.29 g/mol
IUPAC name2,3-dihydro-1H-inden-1-ylmethyl methanesulfonate
InChIKeyCAGQBHMUTKYQIO-UHFFFAOYSA-N
SMILESCS(=O)(=O)OCC1CCC2=CC=CC=C12

Computed by PubChem (NCBI)