CAS 1447972-24-8 appears in our catalog under these names: rac-(1R,3R,5S)-6,6-Difluorobicyclo(3.1.0)hexane-3-carboxylic acid, (1R,3r,5S)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylic acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg.
(1S,5R)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylic acid (CAS 1447972-24-8) is a chemical compound with the molecular formula C7H8F2O2 and a molecular weight of 162.13 g/mol. IUPAC name: (1S,5R)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylic acid. InChIKey: IOQVITCQIHHDBC-NVGWPGHNSA-N.
| Molecular formula | C7H8F2O2 |
|---|---|
| Molecular weight | 162.13 g/mol |
| IUPAC name | (1S,5R)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylic acid |
| InChIKey | IOQVITCQIHHDBC-NVGWPGHNSA-N |
| SMILES | C1[C@@H]2[C@@H](C2(F)F)CC1C(=O)O |
Computed by PubChem (NCBI)