Products 144806-52-0
CAS 144806-52-0 appears in our catalog under these names: 4-(Bromomethyl)-2-chloro-1-nitrobenzene, 97%, 3-Chloro-4-nitrobenzyl bromide, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(bromomethyl)-2-chloro-1-nitrobenzene (CAS 144806-52-0) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 4-(bromomethyl)-2-chloro-1-nitrobenzene. InChIKey: WPFRTERBMAUPIM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 4-(bromomethyl)-2-chloro-1-nitrobenzene |
| InChIKey | WPFRTERBMAUPIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)