Products 1448427-02-8
CAS 1448427-02-8 appears in our catalog under these names: PAWI–2, 1-(4-((3,4-Dihydro-4-methyl-1(2H)-quinoxalinyl)sulfonyl)phenyl)-2-pyrrolidinone, PAWI-2, 99.29%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 50mg, 100mg, 10 mg, 5 mg, 25 mg, 50 mg, 100 mg.
1-[4-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]phenyl]pyrrolidin-2-one (CAS 1448427-02-8) is a chemical compound with the molecular formula C19H21N3O3S and a molecular weight of 371.5 g/mol. IUPAC name: 1-[4-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]phenyl]pyrrolidin-2-one. InChIKey: HKMFKYDGIJGBER-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O3S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 1-[4-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]phenyl]pyrrolidin-2-one |
| InChIKey | HKMFKYDGIJGBER-UHFFFAOYSA-N |
| SMILES | CN1CCN(C2=CC=CC=C21)S(=O)(=O)C3=CC=C(C=C3)N4CCCC4=O |
Computed by PubChem (NCBI)