Products 929975-59-7
CAS 929975-59-7 appears in our catalog under these names: 1-Cyclopentyl-4-methyl-1h-pyrazolo[3,4-b]pyridin-6-yl 4-methylbenzenesulfonate, 95%, 1-Cyclopentyl-4-methyl-1H-pyrazolo(3,4-b)pyridin-6-yl 4-methylbenzene-1-sulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(1-cyclopentyl-4-methylpyrazolo[5,4-b]pyridin-6-yl) 4-methylbenzenesulfonate (CAS 929975-59-7) is a chemical compound with the molecular formula C19H21N3O3S and a molecular weight of 371.5 g/mol. IUPAC name: (1-cyclopentyl-4-methylpyrazolo[5,4-b]pyridin-6-yl) 4-methylbenzenesulfonate. InChIKey: SYRURJRNCVMQBQ-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O3S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | (1-cyclopentyl-4-methylpyrazolo[5,4-b]pyridin-6-yl) 4-methylbenzenesulfonate |
| InChIKey | SYRURJRNCVMQBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=NC3=C(C=NN3C4CCCC4)C(=C2)C |
Computed by PubChem (NCBI)