CAS 296791-77-0 is the registry number for 3-((4-Hydroxy-3-(piperidin-1-ylmethyl)phenyl)amino)benzo[d]isothiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-(piperidin-1-ylmethyl)phenol (CAS 296791-77-0) is a chemical compound with the molecular formula C19H21N3O3S and a molecular weight of 371.5 g/mol. IUPAC name: 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-(piperidin-1-ylmethyl)phenol. InChIKey: UOWOGGFKPZGUTH-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O3S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-(piperidin-1-ylmethyl)phenol |
| InChIKey | UOWOGGFKPZGUTH-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=C(C=CC(=C2)NC3=NS(=O)(=O)C4=CC=CC=C43)O |
Computed by PubChem (NCBI)