CAS 144860-79-7 is the registry number for L 689660 (maleate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-but-2-enedioic acid;3-(6-chloropyrazin-2-yl)-1-azabicyclo[2.2.2]octane (CAS 144860-79-7) is a chemical compound with the molecular formula C15H18ClN3O4 and a molecular weight of 339.77 g/mol. IUPAC name: (Z)-but-2-enedioic acid;3-(6-chloropyrazin-2-yl)-1-azabicyclo[2.2.2]octane. InChIKey: JFXQOIPEIVQLCS-BTJKTKAUSA-N.
| Molecular formula | C15H18ClN3O4 |
|---|---|
| Molecular weight | 339.77 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;3-(6-chloropyrazin-2-yl)-1-azabicyclo[2.2.2]octane |
| InChIKey | JFXQOIPEIVQLCS-BTJKTKAUSA-N |
| SMILES | C1CN2CCC1C(C2)C3=CN=CC(=N3)Cl.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)