Products 201852-69-9
CAS 201852-69-9 appears in our catalog under these names: H–Gly–Ala–AMC · HCl, H-Gly-Ala-AMC monohydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 50mg, 10mg, 25mg, 100mg.
(2S)-2-[(2-aminoacetyl)amino]-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride (CAS 201852-69-9) is a chemical compound with the molecular formula C15H18ClN3O4 and a molecular weight of 339.77 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride. InChIKey: BHERHULYFRFTLU-FVGYRXGTSA-N.
| Molecular formula | C15H18ClN3O4 |
|---|---|
| Molecular weight | 339.77 g/mol |
| IUPAC name | (2S)-2-[(2-aminoacetyl)amino]-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride |
| InChIKey | BHERHULYFRFTLU-FVGYRXGTSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)NC(=O)CN.Cl |
Computed by PubChem (NCBI)