CAS 1797116-63-2 appears in our catalog under these names: Imazamox Impurity 10, alpha-Chloro Imazamox, α-Chloro imazamox. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
6-chloro-5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid (CAS 1797116-63-2) is a chemical compound with the molecular formula C15H18ClN3O4 and a molecular weight of 339.77 g/mol. IUPAC name: 6-chloro-5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid. InChIKey: MHEJPVFVMUHVDV-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN3O4 |
|---|---|
| Molecular weight | 339.77 g/mol |
| IUPAC name | 6-chloro-5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid |
| InChIKey | MHEJPVFVMUHVDV-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=N1)C2=C(C=C(C(=N2)Cl)COC)C(=O)O)C |
Computed by PubChem (NCBI)