CAS 1448675-13-5 appears in our catalog under these names: Potassium trifluoro((4-methoxyphenoxy)methyl)boranuide, 95%, Potassium trifluoro((4-methoxyphenoxy)methyl)boranuide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Potassium trifluoro-[(4-methoxyphenoxy)methyl]boranuide (CAS 1448675-13-5) is a chemical compound with the molecular formula C8H9BF3KO2 and a molecular weight of 244.06 g/mol. IUPAC name: potassium trifluoro-[(4-methoxyphenoxy)methyl]boranuide. InChIKey: KMYDHLDQFPVKLC-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3KO2 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | potassium trifluoro-[(4-methoxyphenoxy)methyl]boranuide |
| InChIKey | KMYDHLDQFPVKLC-UHFFFAOYSA-N |
| SMILES | [B-](COC1=CC=C(C=C1)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)