CAS 871231-42-4 is the registry number for potassium (2,6-dimethoxyphenyl)trifluoroboranuide. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
Potassium (2,6-dimethoxyphenyl)-trifluoroboranuide (CAS 871231-42-4) is a chemical compound with the molecular formula C8H9BF3KO2 and a molecular weight of 244.06 g/mol. IUPAC name: potassium (2,6-dimethoxyphenyl)-trifluoroboranuide. InChIKey: RFOWQNHYQDZXLK-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3KO2 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | potassium (2,6-dimethoxyphenyl)-trifluoroboranuide |
| InChIKey | RFOWQNHYQDZXLK-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC=C1OC)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)