CAS 929626-22-2 appears in our catalog under these names: potassium (3,5–dimethoxyphenyl)trifluoroboranuide, Potassium (3,5-dimethoxyphenyl)trifluoroborate 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
Potassium (3,5-dimethoxyphenyl)-trifluoroboranuide (CAS 929626-22-2) is a chemical compound with the molecular formula C8H9BF3KO2 and a molecular weight of 244.06 g/mol. IUPAC name: potassium (3,5-dimethoxyphenyl)-trifluoroboranuide. InChIKey: QJFSJLQCOKRTQR-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3KO2 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | potassium (3,5-dimethoxyphenyl)-trifluoroboranuide |
| InChIKey | QJFSJLQCOKRTQR-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC(=C1)OC)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)