Products 14487-24-2
CAS 14487-24-2 is the registry number for Benzyl (R)-2-hydroxy-3-methylbutanoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Benzyl (2R)-2-hydroxy-3-methylbutanoate (CAS 14487-24-2) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: benzyl (2R)-2-hydroxy-3-methylbutanoate. InChIKey: XANDRLFOMIFEFY-LLVKDONJSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | benzyl (2R)-2-hydroxy-3-methylbutanoate |
| InChIKey | XANDRLFOMIFEFY-LLVKDONJSA-N |
| SMILES | CC(C)[C@H](C(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)