Products 1448792-38-8

CAS 1448792-38-8 is the registry number for Troponin modulator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

(5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl) 4-methoxybenzoate (CAS 1448792-38-8) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: (5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl) 4-methoxybenzoate. InChIKey: UMKCSAIMUWELPB-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20O6
Molecular weight344.4 g/mol
IUPAC name(5,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl) 4-methoxybenzoate
InChIKeyUMKCSAIMUWELPB-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C(=O)OC2CC3=C(C=C(C=C3OC)OC)OC2

Computed by PubChem (NCBI)

Synonyms: orb3028087