CAS 1448845-14-4 is the registry number for 4-Methyl-N,N-dimethylcathinone hydrochloride. Offered by: Biosynth. Available pack sizes: 1mg, 5mg, 2mg, 10mg, 25mg.
2-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride (CAS 1448845-14-4) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 2-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride. InChIKey: OOGUGYDLTBREKK-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 2-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride |
| InChIKey | OOGUGYDLTBREKK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)N(C)C.Cl |
Computed by PubChem (NCBI)