Products 1448845-14-4

CAS 1448845-14-4 is the registry number for 4-Methyl-N,N-dimethylcathinone hydrochloride. Offered by: Biosynth. Available pack sizes: 1mg, 5mg, 2mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

2-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride (CAS 1448845-14-4) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 2-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride. InChIKey: OOGUGYDLTBREKK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18ClNO
Molecular weight227.73 g/mol
IUPAC name2-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride
InChIKeyOOGUGYDLTBREKK-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(=O)C(C)N(C)C.Cl

Computed by PubChem (NCBI)