Products 1448891-15-3
CAS 1448891-15-3 is the registry number for 1-(6-Chloro-1-methyl-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1-(6-chloro-1-methylindol-3-yl)-2,2,2-trifluoroethanone (CAS 1448891-15-3) is a chemical compound with the molecular formula C11H7ClF3NO and a molecular weight of 261.63 g/mol. IUPAC name: 1-(6-chloro-1-methylindol-3-yl)-2,2,2-trifluoroethanone. InChIKey: AMIDGBPBEJNRMP-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3NO |
|---|---|
| Molecular weight | 261.63 g/mol |
| IUPAC name | 1-(6-chloro-1-methylindol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | AMIDGBPBEJNRMP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=C(C=C2)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)