CAS 852062-05-6 appears in our catalog under these names: 2-Chloro-7-methoxy-4-(trifluoromethyl)quinoline, 95%, 2–Chloro–7–methoxy–4–(trifluoromethyl)quinoline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 50mg.
2-chloro-7-methoxy-4-(trifluoromethyl)quinoline (CAS 852062-05-6) is a chemical compound with the molecular formula C11H7ClF3NO and a molecular weight of 261.63 g/mol. IUPAC name: 2-chloro-7-methoxy-4-(trifluoromethyl)quinoline. InChIKey: PWHTVHQIKXGDTK-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3NO |
|---|---|
| Molecular weight | 261.63 g/mol |
| IUPAC name | 2-chloro-7-methoxy-4-(trifluoromethyl)quinoline |
| InChIKey | PWHTVHQIKXGDTK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)