Products 1701-27-5
CAS 1701-27-5 is the registry number for 4-Chloro-6-methoxy-2-(trifluoromethyl)quinoline, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-chloro-6-methoxy-2-(trifluoromethyl)quinoline (CAS 1701-27-5) is a chemical compound with the molecular formula C11H7ClF3NO and a molecular weight of 261.63 g/mol. IUPAC name: 4-chloro-6-methoxy-2-(trifluoromethyl)quinoline. InChIKey: RVBOGCSHKBTGDA-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3NO |
|---|---|
| Molecular weight | 261.63 g/mol |
| IUPAC name | 4-chloro-6-methoxy-2-(trifluoromethyl)quinoline |
| InChIKey | RVBOGCSHKBTGDA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C=C2Cl)C(F)(F)F |
Computed by PubChem (NCBI)