CAS 1449131-17-2 appears in our catalog under these names: (S)-2-(4-Chlorophenyl)-3-(isopropylamino)propanoic acid hydrochloride, 95%, (S)-2-(4-Chlorophenyl)-3-(isopropylamino)propanoic acid hydrochloride, 95+%, (S)–2–(4–Chlorophenyl)–3–(isopropylamino)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoic acid;hydrochloride (CAS 1449131-17-2) is a chemical compound with the molecular formula C12H17Cl2NO2 and a molecular weight of 278.17 g/mol. IUPAC name: (2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoic acid;hydrochloride. InChIKey: OIAUGYAYLIUNEB-RFVHGSKJSA-N.
| Molecular formula | C12H17Cl2NO2 |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | (2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoic acid;hydrochloride |
| InChIKey | OIAUGYAYLIUNEB-RFVHGSKJSA-N |
| SMILES | CC(C)NC[C@H](C1=CC=C(C=C1)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)