CAS 2044714-28-3 appears in our catalog under these names: 4-Amino-3-(4-chlorophenyl)-4-methylpentanoic acid hydrochloride, 95%, 4-Amino-3-(4-chlorophenyl)-4-methylpentanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
4-amino-3-(4-chlorophenyl)-4-methylpentanoic acid;hydrochloride (CAS 2044714-28-3) is a chemical compound with the molecular formula C12H17Cl2NO2 and a molecular weight of 278.17 g/mol. IUPAC name: 4-amino-3-(4-chlorophenyl)-4-methylpentanoic acid;hydrochloride. InChIKey: MUJIUEGAFAGFBH-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO2 |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | 4-amino-3-(4-chlorophenyl)-4-methylpentanoic acid;hydrochloride |
| InChIKey | MUJIUEGAFAGFBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C(CC(=O)O)C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)