Products 1832241-74-3

CAS 1832241-74-3 is the registry number for N-(4-Chlorobenzyl)-N-propylglycine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-chlorophenyl)methyl-propylamino]acetic acid;hydrochloride (CAS 1832241-74-3) is a chemical compound with the molecular formula C12H17Cl2NO2 and a molecular weight of 278.17 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl-propylamino]acetic acid;hydrochloride. InChIKey: DEBPZCCNYWGNKR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17Cl2NO2
Molecular weight278.17 g/mol
IUPAC name2-[(4-chlorophenyl)methyl-propylamino]acetic acid;hydrochloride
InChIKeyDEBPZCCNYWGNKR-UHFFFAOYSA-N
SMILESCCCN(CC1=CC=C(C=C1)Cl)CC(=O)O.Cl

Computed by PubChem (NCBI)