Products 1449741-54-1
CAS 1449741-54-1 is the registry number for tert-Butyl (1S,5S)-3-oxo-2-azabicyclo[3.1.0]hexane-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (1S,5S)-3-oxo-2-azabicyclo[3.1.0]hexane-2-carboxylate (CAS 1449741-54-1) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: tert-butyl (1S,5S)-3-oxo-2-azabicyclo[3.1.0]hexane-2-carboxylate. InChIKey: APRHZCZIWPERLL-BQBZGAKWSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | tert-butyl (1S,5S)-3-oxo-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| InChIKey | APRHZCZIWPERLL-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2C[C@H]2CC1=O |
Computed by PubChem (NCBI)