CAS 14503-46-9 is the registry number for 2-(Dimethylamino)benzenesulfonic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(dimethylamino)benzenesulfonic acid (CAS 14503-46-9) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-(dimethylamino)benzenesulfonic acid. InChIKey: YXHILBWQUILXRY-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-(dimethylamino)benzenesulfonic acid |
| InChIKey | YXHILBWQUILXRY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC=C1S(=O)(=O)O |
Computed by PubChem (NCBI)