Products 1450657-43-8
CAS 1450657-43-8 is the registry number for Roxadustat Impurity 86. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1S)-1-azido-2-methylsulfonylethyl]-2-ethoxy-1-methoxybenzene (CAS 1450657-43-8) is a chemical compound with the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. IUPAC name: 4-[(1S)-1-azido-2-methylsulfonylethyl]-2-ethoxy-1-methoxybenzene. InChIKey: DOWRHPDZRGIQKB-SNVBAGLBSA-N.
| Molecular formula | C12H17N3O4S |
|---|---|
| Molecular weight | 299.35 g/mol |
| IUPAC name | 4-[(1S)-1-azido-2-methylsulfonylethyl]-2-ethoxy-1-methoxybenzene |
| InChIKey | DOWRHPDZRGIQKB-SNVBAGLBSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N=[N+]=[N-])OC |
Computed by PubChem (NCBI)