CAS 849035-89-8 is the registry number for 1-[4-(Methylsulfonyl)-2-nitrophenyl]-1,4-diazepane, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
1-(4-methylsulfonyl-2-nitrophenyl)-1,4-diazepane (CAS 849035-89-8) is a chemical compound with the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. IUPAC name: 1-(4-methylsulfonyl-2-nitrophenyl)-1,4-diazepane. InChIKey: IYWJJBSLJUDUFN-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4S |
|---|---|
| Molecular weight | 299.35 g/mol |
| IUPAC name | 1-(4-methylsulfonyl-2-nitrophenyl)-1,4-diazepane |
| InChIKey | IYWJJBSLJUDUFN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)N2CCCNCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)