Products 2089650-08-6
CAS 2089650-08-6 appears in our catalog under these names: (5-Ethyl-1，2，4-Oxadiazol-3-Yl)Methanamine 4-Methylbenzenesulfonate, 97%, 97%, (5-Ethyl-1,2,4-oxadiazol-3-yl)methanamine 4-methylbenzenesulfonate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(5-ethyl-1,2,4-oxadiazol-3-yl)methanamine;4-methylbenzenesulfonic acid (CAS 2089650-08-6) is a chemical compound with the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. IUPAC name: (5-ethyl-1,2,4-oxadiazol-3-yl)methanamine;4-methylbenzenesulfonic acid. InChIKey: FEULWHSCPDSGIJ-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4S |
|---|---|
| Molecular weight | 299.35 g/mol |
| IUPAC name | (5-ethyl-1,2,4-oxadiazol-3-yl)methanamine;4-methylbenzenesulfonic acid |
| InChIKey | FEULWHSCPDSGIJ-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=NO1)CN.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)