Products 1451188-54-7
CAS 1451188-54-7 is the registry number for (1,2,3,4-Tetrahydroquinolin-6-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4-tetrahydroquinolin-6-ylboronic acid (CAS 1451188-54-7) is a chemical compound with the molecular formula C9H12BNO2 and a molecular weight of 177.01 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinolin-6-ylboronic acid. InChIKey: NNOYRLPTLGLLOB-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO2 |
|---|---|
| Molecular weight | 177.01 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinolin-6-ylboronic acid |
| InChIKey | NNOYRLPTLGLLOB-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NCCC2)(O)O |
Computed by PubChem (NCBI)