CAS 2225180-85-6 is the registry number for (4–amino–2–cyclopropylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(4-amino-2-cyclopropylphenyl)boronic acid (CAS 2225180-85-6) is a chemical compound with the molecular formula C9H12BNO2 and a molecular weight of 177.01 g/mol. IUPAC name: (4-amino-2-cyclopropylphenyl)boronic acid. InChIKey: CDRZNIKLCPGTPU-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO2 |
|---|---|
| Molecular weight | 177.01 g/mol |
| IUPAC name | (4-amino-2-cyclopropylphenyl)boronic acid |
| InChIKey | CDRZNIKLCPGTPU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N)C2CC2)(O)O |
Computed by PubChem (NCBI)