CAS 2803902-92-1 is the registry number for (E)-(2-(2,6-Dimethylpyridin-4-yl)vinyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(E)-2-(2,6-dimethyl-4-pyridinyl)ethenyl]boronic acid (CAS 2803902-92-1) is a chemical compound with the molecular formula C9H12BNO2 and a molecular weight of 177.01 g/mol. IUPAC name: [(E)-2-(2,6-dimethyl-4-pyridinyl)ethenyl]boronic acid. InChIKey: CMNIUYCVIYOXCL-ONEGZZNKSA-N.
| Molecular formula | C9H12BNO2 |
|---|---|
| Molecular weight | 177.01 g/mol |
| IUPAC name | [(E)-2-(2,6-dimethyl-4-pyridinyl)ethenyl]boronic acid |
| InChIKey | CMNIUYCVIYOXCL-ONEGZZNKSA-N |
| SMILES | B(/C=C/C1=CC(=NC(=C1)C)C)(O)O |
Computed by PubChem (NCBI)